Consider the formation of p-nitrophenol from p-nitrophenyl trimethyl acetate. The process is known as enzymatic hydrolysis and it occurs in the presence of the enzyme elastase. Along with the formation of p-nitrophenol, trimethyl acetic acid is also formed which is an undesired byproduct. p-nitrophenol is an important intermediate in the manufacture of several pharmaceuticals. Your role as a Chemical Engineer is to maximize the production of p-nitrophenol. The reactions can be denoted as: E+S â

1 answer
Question:

Consider the formation of p-nitrophenol from p-nitrophenyl trimethyl acetate. The process is known as enzymatic hydrolysis and it occurs in the presence of the enzyme elastase. Along with the formation of p-nitrophenol, trimethyl acetic acid is also formed which is an undesired byproduct. p-nitrophenol is an important intermediate in the manufacture of several pharmaceuticals. Your role as a Chemical Engineer is to maximize the production of p-nitrophenol. The reactions can be denoted as:
E+S → P+ES R1
ES+PE+A R2
where e denotes the enzyme elastase, denotes the substrate p-nitrophenyl trimethyl acetate, es denotes enzyme-substrate intermediate and A denotes the trimethyl acetic acid. The rate of the reactions 1 and 2 are given by:
kg Cs KM + C r2 = kxCp
where Cs and Cp denote the concentrations of the substrate and the product, k, and ky are the rate constants given by 0.015 s' and 0.0026 s. Ky is the Michaelis - Menten constant and is given by 5.53 mol/m!. All the reactants and products are in the liquid phase. The initial concentrations of S and E are 0.5 mol/m3 and 0.001 mol/m..Consider the above reaction to occur in a batch reactor for 15 minutes.
a. Plot the concentration profiles of S, P and A as a function of time in a single figure.
b. Plot the selectivity of P with respect to 5 as a function of time b.

Answers

Solution :cs=zeros(9001); ca=zeros(9001); cp=zeros(9001); psi=zeros(9001); t=[0:0.1:900]; cs(1)=0.5; ce(1)=0.001; cp(1)=0; ca(1)=0; psi(1)=0; for i=1:1:9000 cs(i+1)=cs(i)-0.1*((0.015*cs(i))/(5.53+cs(i))); cp(i+1)=cp(i)+0.1*((0.015*cs(i))/(5.53+cs(i))-0.0026*cp(i)); ca(i+1)=ca(i)+0.1*0.0026*cp(i); psi(i+1)=((cp(i+1)-cp(i)))/((cs(i)-cs(i+1))); end plot(t,cs,t,cp,t,ca); plot(t,psi);

Similar Solved Questions

2 answers

Please help a. they both have a town nearby b. they both have kitchens c. they both have spas d. they both have unlimited internet

please help a. they both have a town nearby b. they both have kitchens c. they both have spas d. they both have unlimited internet...
1 answer

Which country does not border india?

Which country does not border india?...
1 answer

I need help finding a rational number in between 9.5 and 9.7​

i need help finding a rational number in between 9.5 and 9.7​...
1 answer

Please help me fast, I will give brainliest if correct!

Please help me fast, I will give brainliest if correct!...
1 answer

The trapezium is down on a centimetre grid find the area of the trapezium​

the trapezium is down on a centimetre grid find the area of the trapezium​...
1 answer

Find the volume in the shape

Find the volume in the shape...
2 answers

I need help pls is due today

I need help pls is due today...
1 answer

How do rates help you describe real life problem? Give two example

how do rates help you describe real life problem? Give two example...
2 answers

Why didn't George Atzerodt kill Vice President Johnson? Helppppp

Why didn't George Atzerodt kill Vice President Johnson? Helppppp...
1 answer

7. Find the distance between the points (13, 8) and (-12, 6)

7. Find the distance between the points (13, 8) and (-12, 6)...
1 answer

How did life after agriculture change in the cultures that developed it?

how did life after agriculture change in the cultures that developed it?...
1 answer

Three boxes are stacked one on top of the other. One box is 4 feet 7 inches tall, one is 6 feet 8 inches tall, and one is 4 feet 6 inches tall. How high is the stack? Write your answer in feet and inches. Use a number less than 12 for inches.

Three boxes are stacked one on top of the other. One box is 4 feet 7 inches tall, one is 6 feet 8 inches tall, and one is 4 feet 6 inches tall. How high is the stack? Write your answer in feet and inches. Use a number less than 12 for inches....
2 answers

What is the main difference between the concepts of colonialism and imperialism?

What is the main difference between the concepts of colonialism and imperialism?...
1 answer

Maren is painting some doors that are all the same size. She used 3 liters of paint to cover 1 4/5 doors. How many liters of paint are needed for 1 door?

Maren is painting some doors that are all the same size. She used 3 liters of paint to cover 1 4/5 doors. How many liters of paint are needed for 1 door?...
1 answer

One reason that Greek culture spread outside the Greek Peninsula was A. farmers cultivated the dry land B. sea traders traveled around the Aegean Sea C. writers had their plays published around the world D. most Greeks left Greece because of extreme povertyGive 20 points and mark brainliest!

One reason that Greek culture spread outside the Greek Peninsula was A. farmers cultivated the dry land B. sea traders traveled around the Aegean Sea C. writers had their plays published around the world D. most Greeks left Greece because of extreme povertyGive 20 points and mark brainliest!...
1 answer

Jeri's lawn service charges an initial fee of $4.50 plus $3 an hour. If she is asked to start before 7 a.m., Jeri charges 1.5 times the regular amount. If she made $29.25 on a job that began at 5 am, how many hours did Jeri work? h = the number of hours that Jeri worked 1.5(3h + 4.50) = 29.25 1.50 3 + 1.5(4.50) = 29.25 4.5h + 6.75 = I 6.75 4.5h = - 6.75 22.5 22.5 4.5h 4.5 h=

Jeri's lawn service charges an initial fee of $4.50 plus $3 an hour. If she is asked to start before 7 a.m., Jeri charges 1.5 times the regular amount. If she made $29.25 on a job that began at 5 am, how many hours did Jeri work? h = the number of hours that Jeri worked 1.5(3h + 4.50) = 29.25 1.50 3...
2 answers

Which of these lists shows the elements common to every story? plot, facts, opinions plot, characters, setting setting, sentences, paragraphs characters, arguments, details

Which of these lists shows the elements common to every story? plot, facts, opinions plot, characters, setting setting, sentences, paragraphs characters, arguments, details...
1 answer

Tickets to a museum cost $17 each. for a field trip, the museum offers a $4 discount on each ticket. how much will tickets for 32 students coast?

Tickets to a museum cost $17 each. for a field trip, the museum offers a $4 discount on each ticket. how much will tickets for 32 students coast?...

-- 0.014650--