ABC is a straight line. The length of AB is four times the length of BC. AC = 75 cm. Work out the length of AB.
1 answer
Question:
ABC is a straight line.
The length of AB is four times the length of BC.
AC = 75 cm.
Work out the length of AB.
Answers
Answer:Step-by-step explanation:What is known....AC=75 AB=4 times BC AB+BC=AC4(BC)+BC=75 Add like numbers4(BC)+BC=5BC5(BC)=75 get the variable(BC) alone by dividing both sides by the number(5)5(BC)/5=75/5 Then simplify....5(BC)/5=(BC) and 75/7=15(BC)=15
Similar Solved Questions
1 answer
In your own words, what are the strengths and weaknesses of forecasting? In Business Analytics
In your own words, what are the strengths and
weaknesses of forecasting?
In Business Analytics...
2 answers
What’s the structure of carbohydrates (monomers)
what’s the structure of carbohydrates (monomers)...
1 answer
PLEASE HELP ASAP. NEED IT DONE NOW(PLEASE SOLVE FOR X USING INVERSE OPERATIONS)
PLEASE HELP ASAP. NEED IT DONE NOW(PLEASE SOLVE FOR X USING INVERSE OPERATIONS)...
1 answer
I bought 45 oz of flour. She used 15.6 oz to make a loaf of bread, 0.71 oz for each muffin. How many muffins were made if you have 18.04 oz left over?
I bought 45 oz of flour. She used 15.6 oz to make a loaf of bread, 0.71 oz for each muffin. How many muffins were made if you have 18.04 oz left over?...
1 answer
View from the Sun. Suppose you lived on the Sun (and could ignore the heat). Would you still see the Moon go through phases as it orbits Earth? Explain
View from the Sun. Suppose you lived on the Sun (and could ignore the heat). Would you still see the Moon go through phases as it orbits Earth? Explain...
1 answer
Rashad is filling a toy box with wooden blocks that are each a unit cube in size He filled the bottom layer of a toy box with 15 wooden blocks He then stacked two more wooden blocks on the top of the bottom layer The partially filled box is shown below
Rashad is filling a toy box with wooden blocks that are each a unit cube in size He filled the bottom layer of a toy box with 15 wooden blocks He then stacked two more wooden blocks on the top of the bottom layer The partially filled box is shown below...
1 answer
HELP HELP ASAP PLEASE! will give brainlie s t Graph f(x)=2x+1 and g(x)=−x+4 on the same coordinate plane. What is the solution to the equation f(x)=g(x) ? Enter your answer in the box. x =
HELP HELP ASAP PLEASE! will give brainlie s t
Graph f(x)=2x+1 and g(x)=−x+4 on the same coordinate plane.
What is the solution to the equation f(x)=g(x) ?
Enter your answer in the box.
x =...
2 answers
How did Catholic leaders encourage change during the Catholic Reformation? through a return to simony through a return to community service with a break from the sacraments with a break from church expansion
How did Catholic leaders encourage change during the Catholic Reformation? through a return to simony through a return to community service with a break from the sacraments with a break from church expansion...
2 answers
The volume of a cube is 343 cubic yards. how long are the sides
The volume of a cube is 343 cubic yards. how long are the sides...
2 answers
Consuming medium doses of alcohol is likely to cause
Consuming medium doses of alcohol is likely to cause...
2 answers
Describe a town that follows feudalism (3 sentence minimum)
Describe a town that follows feudalism (3 sentence minimum)...
1 answer
Why do you think that only single-celled organisms live In the hadalpelagic zone? please give a detailed answer.
why do you think that only single-celled organisms live In the hadalpelagic zone? please give a detailed answer....
1 answer
Find the surface area of a sphere with radius of 60 centimeters. Leave your answer in terms of pi
Find the surface area of a sphere with radius of 60 centimeters. Leave your answer in terms of pi...
1 answer
Why did many European investors support American entrepreneurship in the late 1800s
Why did many European investors support American entrepreneurship in the late 1800s...
2 answers
Stanley is putting wallpaper strips on his bathroom
stanley is putting wallpaper strips on his bathroom...
1 answer
What does Dr. Heidegger show his guests? A He makes a flower disappear. on, B He makes all the water in a vase disappear, sucked into a flower, ng as own; within He makes a nice rose water tonic for them.. D He makes a dead flower bloom again.
What does Dr. Heidegger show his guests?
A
He makes a flower disappear.
on,
B
He makes all the water in a vase disappear, sucked into a flower,
ng as
own;
within
He makes a nice rose water tonic for them..
D
He makes a dead flower bloom again....
1 answer
As cells increase in size, what happens to the amount of DNA the cells has? A) they have more DNA B) they have the same amount of DNA C) they get less DNA
As cells increase in size, what happens to the amount of DNA the cells has?
A) they have more DNA
B) they have the same amount of DNA
C) they get less DNA...